C11H11N5O3S — CID 115937021
2-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)-3-nitrobenzamide (PubChem CID 115937021) has the molecular formula C11H11N5O3S and a molecular weight of 293.31 g/mol. Its IUPAC name is 2-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)-3-nitrobenzamide.
| Compound Name | 2-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 115937021 |
| Molecular Formula | C11H11N5O3S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-hydrazinyl-N-(5-methyl-1,3-thiazol-2-yl)-3-nitrobenzamide |
| SMILES | Cc1cnc(NC(=O)c2cccc([N+](=O)[O-])c2NN)s1 |
| InChI | InChI=1S/C11H11N5O3S/c1-6-5-13-11(20-6)14-10(17)7-3-2-4-8(16(18)19)9(7)15-12/h2-5,15H,12H2,1H3,(H,13,14,17) |
| InChIKey | RLEWAUHLECSEOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|