About 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one
5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one (PubChem CID 11593747) has the molecular formula C9H14O4S
and a molecular weight of 218.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one.
Molecular Properties
| Compound Name | 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one |
| PubChem CID | 11593747 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one |
| SMILES | COCOC1=C(C)C(=O)SC1(C)CO |
| InChI | InChI=1S/C9H14O4S/c1-6-7(13-5-12-3)9(2,4-10)14-8(6)11/h10H,4-5H2,1-3H3 |
| InChIKey | YIULPYQSQOPDRK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one?
The IUPAC name of 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one (CID 11593747) is 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one.
What is the SMILES notation for 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one?
The canonical SMILES for 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one is COCOC1=C(C)C(=O)SC1(C)CO.
What is the InChIKey of 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one?
The InChIKey is YIULPYQSQOPDRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O4S/c1-6-7(13-5-12-3)9(2,4-10)14-8(6)11/h10H,4-5H2,1-3H3.
What are the key properties of 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one?
5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one has a molecular weight of 218.27 g/mol, XLogP of 0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(hydroxymethyl)-4-(methoxymethoxy)-3,5-dimethylthiophen-2-one is sourced from PubChem (CID 11593747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).