C15H13BrN4O — CID 115937864
N-[(6-bromo-2-pyridinyl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 115937864) has the molecular formula C15H13BrN4O and a molecular weight of 345.20 g/mol. Its IUPAC name is N-[(6-bromo-2-pyridinyl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | N-[(6-bromo-2-pyridinyl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 115937864 |
| Molecular Formula | C15H13BrN4O |
| Molecular Weight | 345.20 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | N-[(6-bromo-2-pyridinyl)methyl]-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Cc1noc(-c2ccccc2NCc2cccc(Br)n2)n1 |
| InChI | InChI=1S/C15H13BrN4O/c1-10-18-15(21-20-10)12-6-2-3-7-13(12)17-9-11-5-4-8-14(16)19-11/h2-8,17H,9H2,1H3 |
| InChIKey | AMGNDAUIXVQJOF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|