C15H13BrFN3O — CID 115938007
7-[(6-bromo-2-pyridinyl)methylamino]-6-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 115938007) has the molecular formula C15H13BrFN3O and a molecular weight of 350.19 g/mol. Its IUPAC name is 7-[(6-bromo-2-pyridinyl)methylamino]-6-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[(6-bromo-2-pyridinyl)methylamino]-6-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 115938007 |
| Molecular Formula | C15H13BrFN3O |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 7-[(6-bromo-2-pyridinyl)methylamino]-6-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(F)c(NCc3cccc(Br)n3)cc2N1 |
| InChI | InChI=1S/C15H13BrFN3O/c16-14-3-1-2-10(19-14)8-18-13-7-12-9(6-11(13)17)4-5-15(21)20-12/h1-3,6-7,18H,4-5,8H2,(H,20,21) |
| InChIKey | FFEWMPNVKQDPCE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|