C16H19FN2O — CID 115938696
1-[2-[1-(5-fluoro-2-pyridinyl)propylamino]phenyl]ethanol (PubChem CID 115938696) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-[2-[1-(5-fluoro-2-pyridinyl)propylamino]phenyl]ethanol.
| Compound Name | 1-[2-[1-(5-fluoro-2-pyridinyl)propylamino]phenyl]ethanol |
|---|---|
| PubChem CID | 115938696 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-[2-[1-(5-fluoro-2-pyridinyl)propylamino]phenyl]ethanol |
| SMILES | CCC(Nc1ccccc1C(C)O)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H19FN2O/c1-3-14(16-9-8-12(17)10-18-16)19-15-7-5-4-6-13(15)11(2)20/h4-11,14,19-20H,3H2,1-2H3 |
| InChIKey | SZLNTQJAWSADQO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |