C17H31N3 — CID 115939346
N-methyl-N-(3-methylbutyl)-6-[1-(propylamino)propyl]pyridin-3-amine (PubChem CID 115939346) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-methyl-N-(3-methylbutyl)-6-[1-(propylamino)propyl]pyridin-3-amine.
| Compound Name | N-methyl-N-(3-methylbutyl)-6-[1-(propylamino)propyl]pyridin-3-amine |
|---|---|
| PubChem CID | 115939346 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | N-methyl-N-(3-methylbutyl)-6-[1-(propylamino)propyl]pyridin-3-amine |
| SMILES | CCCNC(CC)c1ccc(N(C)CCC(C)C)cn1 |
| InChI | InChI=1S/C17H31N3/c1-6-11-18-16(7-2)17-9-8-15(13-19-17)20(5)12-10-14(3)4/h8-9,13-14,16,18H,6-7,10-12H2,1-5H3 |
| InChIKey | WJRVOHDMARZBNQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |