C13H14O5 — CID 11593996
(2E,7E)-8-(4-methyl-2,5-dioxofuran-3-yl)octa-2,7-dienoic acid (PubChem CID 11593996) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is (2E,7E)-8-(4-methyl-2,5-dioxofuran-3-yl)octa-2,7-dienoic acid.
| Compound Name | (2E,7E)-8-(4-methyl-2,5-dioxofuran-3-yl)octa-2,7-dienoic acid |
|---|---|
| PubChem CID | 11593996 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2E,7E)-8-(4-methyl-2,5-dioxofuran-3-yl)octa-2,7-dienoic acid |
| SMILES | CC1=C(/C=C/CCC/C=C/C(=O)O)C(=O)OC1=O |
| InChI | InChI=1S/C13H14O5/c1-9-10(13(17)18-12(9)16)7-5-3-2-4-6-8-11(14)15/h5-8H,2-4H2,1H3,(H,14,15)/b7-5+,8-6+ |
| InChIKey | HCSKILVSDLILBO-KQQUZDAGSA-N |
| XLogP | 1.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|