C16H24FN3 — CID 115940611
5-[1-(5-fluoro-2-pyridinyl)propyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 115940611) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is 5-[1-(5-fluoro-2-pyridinyl)propyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-[1-(5-fluoro-2-pyridinyl)propyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 115940611 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 5-[1-(5-fluoro-2-pyridinyl)propyl]-4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CCC(c1ccc(F)cn1)N1CC2CNCC2C1(C)C |
| InChI | InChI=1S/C16H24FN3/c1-4-15(14-6-5-12(17)8-19-14)20-10-11-7-18-9-13(11)16(20,2)3/h5-6,8,11,13,15,18H,4,7,9-10H2,1-3H3 |
| InChIKey | VOZVCMYWCWNUFD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |