C10H15N3OS — CID 11594121
(3R,6S,7aS)-6-amino-5-oxo-6-propan-2-yl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile (PubChem CID 11594121) has the molecular formula C10H15N3OS and a molecular weight of 225.32 g/mol. Its IUPAC name is (3R,6S,7aS)-6-amino-5-oxo-6-propan-2-yl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile.
| Compound Name | (3R,6S,7aS)-6-amino-5-oxo-6-propan-2-yl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
|---|---|
| PubChem CID | 11594121 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (3R,6S,7aS)-6-amino-5-oxo-6-propan-2-yl-2,3,7,7a-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carbonitrile |
| SMILES | CC(C)[C@@]1(N)C[C@@H]2SC[C@@H](C#N)N2C1=O |
| InChI | InChI=1S/C10H15N3OS/c1-6(2)10(12)3-8-13(9(10)14)7(4-11)5-15-8/h6-8H,3,5,12H2,1-2H3/t7-,8+,10+/m1/s1 |
| InChIKey | PHHPHCXYJVYFHJ-WEDXCCLWSA-N |
| XLogP | 0.54 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |