C17H35NO2 — CID 115942105
[4-tert-butyl-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexyl]methanamine (PubChem CID 115942105) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is [4-tert-butyl-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexyl]methanamine.
| Compound Name | [4-tert-butyl-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexyl]methanamine |
|---|---|
| PubChem CID | 115942105 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | [4-tert-butyl-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]cyclohexyl]methanamine |
| SMILES | CC(C)(C)OCCOC1(CN)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H35NO2/c1-15(2,3)14-7-9-17(13-18,10-8-14)20-12-11-19-16(4,5)6/h14H,7-13,18H2,1-6H3 |
| InChIKey | YCILHWRHWHNTKH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|