C17H21NO2 — CID 11594232
1-[(3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone (PubChem CID 11594232) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-[(3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone.
| Compound Name | 1-[(3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone |
|---|---|
| PubChem CID | 11594232 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 1-[(3S,8aR)-5,8a-dimethyl-3-phenyl-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-6-yl]ethanone |
| SMILES | CC(=O)C1=C(C)N2[C@@H](c3ccccc3)CO[C@]2(C)CC1 |
| InChI | InChI=1S/C17H21NO2/c1-12-15(13(2)19)9-10-17(3)18(12)16(11-20-17)14-7-5-4-6-8-14/h4-8,16H,9-11H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | YNNCDTXSDZBTPH-IAGOWNOFSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |