C19H26Si — CID 11594368
trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane (PubChem CID 11594368) has the molecular formula C19H26Si and a molecular weight of 282.50 g/mol. Its IUPAC name is trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane.
| Compound Name | trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane |
|---|---|
| PubChem CID | 11594368 |
| Molecular Formula | C19H26Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane |
| SMILES | CCCCCC=C=Cc1ccccc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H26Si/c1-5-6-7-8-9-10-13-18-14-11-12-15-19(18)16-17-20(2,3)4/h9,11-15H,5-8H2,1-4H3 |
| InChIKey | FQZCYGBUUUDBRE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|