About trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane
trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane (PubChem CID 11594368) has the molecular formula C19H26Si
and a molecular weight of 282.50 g/mol. Its IUPAC name is trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane.
Molecular Properties
| Compound Name | trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane |
| PubChem CID | 11594368 |
| Molecular Formula | C19H26Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane |
| SMILES | CCCCCC=C=Cc1ccccc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C19H26Si/c1-5-6-7-8-9-10-13-18-14-11-12-15-19(18)16-17-20(2,3)4/h9,11-15H,5-8H2,1-4H3 |
| InChIKey | FQZCYGBUUUDBRE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane?
The IUPAC name of trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane (CID 11594368) is trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane.
What is the SMILES notation for trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane?
The canonical SMILES for trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane is CCCCCC=C=Cc1ccccc1C#C[Si](C)(C)C.
What is the InChIKey of trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane?
The InChIKey is FQZCYGBUUUDBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26Si/c1-5-6-7-8-9-10-13-18-14-11-12-15-19(18)16-17-20(2,3)4/h9,11-15H,5-8H2,1-4H3.
What are the key properties of trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane?
trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane has a molecular weight of 282.50 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl-[2-(2-octa-1,2-dienylphenyl)ethynyl]silane is sourced from PubChem (CID 11594368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).