C17H12Cl2OS — CID 115945221
4-[(2,6-dichlorophenyl)methylsulfanyl]naphthalen-1-ol (PubChem CID 115945221) has the molecular formula C17H12Cl2OS and a molecular weight of 335.26 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methylsulfanyl]naphthalen-1-ol.
| Compound Name | 4-[(2,6-dichlorophenyl)methylsulfanyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 115945221 |
| Molecular Formula | C17H12Cl2OS |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methylsulfanyl]naphthalen-1-ol |
| SMILES | Oc1ccc(SCc2c(Cl)cccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C17H12Cl2OS/c18-14-6-3-7-15(19)13(14)10-21-17-9-8-16(20)11-4-1-2-5-12(11)17/h1-9,20H,10H2 |
| InChIKey | XCYSWBPAMFWKIE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |