C15H15N3O3 — CID 115945781
2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile (PubChem CID 115945781) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile.
| Compound Name | 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile |
|---|---|
| PubChem CID | 115945781 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2-(5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl)benzonitrile |
| SMILES | CCC1(CC)C(=O)NC(=O)N(c2ccccc2C#N)C1=O |
| InChI | InChI=1S/C15H15N3O3/c1-3-15(4-2)12(19)17-14(21)18(13(15)20)11-8-6-5-7-10(11)9-16/h5-8H,3-4H2,1-2H3,(H,17,19,21) |
| InChIKey | DVMWLJGTVFOHEA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|