C14H15FN2O3 — CID 115945917
1-[(4-fluorophenyl)methyl]-5-propan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 115945917) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-5-propan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-[(4-fluorophenyl)methyl]-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115945917 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C1C(=O)NC(=O)N(Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C14H15FN2O3/c1-8(2)11-12(18)16-14(20)17(13(11)19)7-9-3-5-10(15)6-4-9/h3-6,8,11H,7H2,1-2H3,(H,16,18,20) |
| InChIKey | SXNLEDKQTFQBNS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|