C14H12Cl2N2O3 — CID 115946527
9-(2,3-dichlorophenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 115946527) has the molecular formula C14H12Cl2N2O3 and a molecular weight of 327.17 g/mol. Its IUPAC name is 9-(2,3-dichlorophenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-(2,3-dichlorophenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 115946527 |
| Molecular Formula | C14H12Cl2N2O3 |
| Molecular Weight | 327.17 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 9-(2,3-dichlorophenyl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | O=C1NC(=O)C2(CCCC2)C(=O)N1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H12Cl2N2O3/c15-8-4-3-5-9(10(8)16)18-12(20)14(6-1-2-7-14)11(19)17-13(18)21/h3-5H,1-2,6-7H2,(H,17,19,21) |
| InChIKey | GYWNJMNJXHXJTF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.17 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|