C14H15IN2O3 — CID 115946633
5,5-diethyl-1-(4-iodophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 115946633) has the molecular formula C14H15IN2O3 and a molecular weight of 386.19 g/mol. Its IUPAC name is 5,5-diethyl-1-(4-iodophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-(4-iodophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115946633 |
| Molecular Formula | C14H15IN2O3 |
| Molecular Weight | 386.19 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | 5,5-diethyl-1-(4-iodophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(c2ccc(I)cc2)C1=O |
| InChI | InChI=1S/C14H15IN2O3/c1-3-14(4-2)11(18)16-13(20)17(12(14)19)10-7-5-9(15)6-8-10/h5-8H,3-4H2,1-2H3,(H,16,18,20) |
| InChIKey | OBVQAYVVGYQIOR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|