C18H15NO4 — CID 11594731
9-(hydroxymethyl)-5,5-dimethyl-6,18-dioxa-16-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,8,12(17),13,15-heptaen-11-one (PubChem CID 11594731) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is 9-(hydroxymethyl)-5,5-dimethyl-6,18-dioxa-16-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,8,12(17),13,15-heptaen-11-one.
| Compound Name | 9-(hydroxymethyl)-5,5-dimethyl-6,18-dioxa-16-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,8,12(17),13,15-heptaen-11-one |
|---|---|
| PubChem CID | 11594731 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 9-(hydroxymethyl)-5,5-dimethyl-6,18-dioxa-16-azatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2(7),3,8,12(17),13,15-heptaen-11-one |
| SMILES | CC1(C)C=Cc2c(cc(CO)c3c(=O)c4cccnc4oc23)O1 |
| InChI | InChI=1S/C18H15NO4/c1-18(2)6-5-11-13(23-18)8-10(9-20)14-15(21)12-4-3-7-19-17(12)22-16(11)14/h3-8,20H,9H2,1-2H3 |
| InChIKey | XCPHVUZDDTWGFP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|