C16H26N2O3 — CID 115947509
5,5-diethyl-1-(4-ethylcyclohexyl)-1,3-diazinane-2,4,6-trione (PubChem CID 115947509) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 5,5-diethyl-1-(4-ethylcyclohexyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-(4-ethylcyclohexyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115947509 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 5,5-diethyl-1-(4-ethylcyclohexyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1CCC(N2C(=O)NC(=O)C(CC)(CC)C2=O)CC1 |
| InChI | InChI=1S/C16H26N2O3/c1-4-11-7-9-12(10-8-11)18-14(20)16(5-2,6-3)13(19)17-15(18)21/h11-12H,4-10H2,1-3H3,(H,17,19,21) |
| InChIKey | AAKHJYIYYLTCGS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|