C14H16N2O3S — CID 115947529
8-(1-thiophen-3-ylpropan-2-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 115947529) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 8-(1-thiophen-3-ylpropan-2-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-(1-thiophen-3-ylpropan-2-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 115947529 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 8-(1-thiophen-3-ylpropan-2-yl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | CC(Cc1ccsc1)N1C(=O)NC(=O)C2(CCC2)C1=O |
| InChI | InChI=1S/C14H16N2O3S/c1-9(7-10-3-6-20-8-10)16-12(18)14(4-2-5-14)11(17)15-13(16)19/h3,6,8-9H,2,4-5,7H2,1H3,(H,15,17,19) |
| InChIKey | JBGVMALMTLNHPF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|