C14H21N3O4 — CID 115947718
2-(5-cyclopentyl-2,4,6-trioxo-1,3-diazinan-1-yl)-N-ethylpropanamide (PubChem CID 115947718) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(5-cyclopentyl-2,4,6-trioxo-1,3-diazinan-1-yl)-N-ethylpropanamide.
| Compound Name | 2-(5-cyclopentyl-2,4,6-trioxo-1,3-diazinan-1-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 115947718 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-(5-cyclopentyl-2,4,6-trioxo-1,3-diazinan-1-yl)-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)N1C(=O)NC(=O)C(C2CCCC2)C1=O |
| InChI | InChI=1S/C14H21N3O4/c1-3-15-11(18)8(2)17-13(20)10(9-6-4-5-7-9)12(19)16-14(17)21/h8-10H,3-7H2,1-2H3,(H,15,18)(H,16,19,21) |
| InChIKey | QGIJYGLNBRTGCA-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|