C14H14N2O4 — CID 115947921
7-(4-methoxy-2-methylphenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 115947921) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 7-(4-methoxy-2-methylphenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(4-methoxy-2-methylphenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 115947921 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 7-(4-methoxy-2-methylphenyl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)C3(CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C14H14N2O4/c1-8-7-9(20-2)3-4-10(8)16-12(18)14(5-6-14)11(17)15-13(16)19/h3-4,7H,5-6H2,1-2H3,(H,15,17,19) |
| InChIKey | AXOXHOGXNAZVRQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|