C12H9F3N2O3 — CID 115947928
5-ethyl-6-hydroxy-1-(2,4,5-trifluorophenyl)pyrimidine-2,4-dione (PubChem CID 115947928) has the molecular formula C12H9F3N2O3 and a molecular weight of 286.21 g/mol. Its IUPAC name is 5-ethyl-6-hydroxy-1-(2,4,5-trifluorophenyl)pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-6-hydroxy-1-(2,4,5-trifluorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115947928 |
| Molecular Formula | C12H9F3N2O3 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 5-ethyl-6-hydroxy-1-(2,4,5-trifluorophenyl)pyrimidine-2,4-dione |
| SMILES | CCc1c(O)n(-c2cc(F)c(F)cc2F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H9F3N2O3/c1-2-5-10(18)16-12(20)17(11(5)19)9-4-7(14)6(13)3-8(9)15/h3-4,19H,2H2,1H3,(H,16,18,20) |
| InChIKey | UJTUCEYPNUFLGC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|