C13H12BrClN2O3 — CID 115947982
1-(5-bromo-2-chlorophenyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 115947982) has the molecular formula C13H12BrClN2O3 and a molecular weight of 359.61 g/mol. Its IUPAC name is 1-(5-bromo-2-chlorophenyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(5-bromo-2-chlorophenyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 115947982 |
| Molecular Formula | C13H12BrClN2O3 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | 1-(5-bromo-2-chlorophenyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)C1C(=O)NC(=O)N(c2cc(Br)ccc2Cl)C1=O |
| InChI | InChI=1S/C13H12BrClN2O3/c1-6(2)10-11(18)16-13(20)17(12(10)19)9-5-7(14)3-4-8(9)15/h3-6,10H,1-2H3,(H,16,18,20) |
| InChIKey | JVVKBMOJPJRKFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|