C13H13N3O4 — CID 115948048
7-[(2-methoxy-4-pyridinyl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 115948048) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 7-[(2-methoxy-4-pyridinyl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-[(2-methoxy-4-pyridinyl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 115948048 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 7-[(2-methoxy-4-pyridinyl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | COc1cc(CN2C(=O)NC(=O)C3(CC3)C2=O)ccn1 |
| InChI | InChI=1S/C13H13N3O4/c1-20-9-6-8(2-5-14-9)7-16-11(18)13(3-4-13)10(17)15-12(16)19/h2,5-6H,3-4,7H2,1H3,(H,15,17,19) |
| InChIKey | PCICUFBCYJVZGE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|