C12H21N3O5S — CID 115948315
N-[2-methyl-1-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)propan-2-yl]methanesulfonamide (PubChem CID 115948315) has the molecular formula C12H21N3O5S and a molecular weight of 319.38 g/mol. Its IUPAC name is N-[2-methyl-1-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)propan-2-yl]methanesulfonamide.
| Compound Name | N-[2-methyl-1-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)propan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 115948315 |
| Molecular Formula | C12H21N3O5S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[2-methyl-1-(2,4,6-trioxo-5-propan-2-yl-1,3-diazinan-1-yl)propan-2-yl]methanesulfonamide |
| SMILES | CC(C)C1C(=O)NC(=O)N(CC(C)(C)NS(C)(=O)=O)C1=O |
| InChI | InChI=1S/C12H21N3O5S/c1-7(2)8-9(16)13-11(18)15(10(8)17)6-12(3,4)14-21(5,19)20/h7-8,14H,6H2,1-5H3,(H,13,16,18) |
| InChIKey | UURDBOFKPKBRKC-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|