C13H16N2O5S — CID 115948559
4-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 115948559) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 4-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 115948559 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | O=C1NC(=O)C2(CCCCC2)C(=O)N1C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C13H16N2O5S/c16-10-13(5-2-1-3-6-13)11(17)15(12(18)14-10)9-4-7-21(19,20)8-9/h4,7,9H,1-3,5-6,8H2,(H,14,16,18) |
| InChIKey | FFBREVTZLOUSGO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|