C13H9Cl2FN2O3 — CID 115949008
8-(2,6-dichloro-4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 115949008) has the molecular formula C13H9Cl2FN2O3 and a molecular weight of 331.13 g/mol. Its IUPAC name is 8-(2,6-dichloro-4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-(2,6-dichloro-4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 115949008 |
| Molecular Formula | C13H9Cl2FN2O3 |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 8-(2,6-dichloro-4-fluorophenyl)-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | O=C1NC(=O)C2(CCC2)C(=O)N1c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O3/c14-7-4-6(16)5-8(15)9(7)18-11(20)13(2-1-3-13)10(19)17-12(18)21/h4-5H,1-3H2,(H,17,19,21) |
| InChIKey | PRSGXAHKLUPHQU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|