C13H16N4O3 — CID 115949050
9-[(1-methylpyrazol-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 115949050) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 9-[(1-methylpyrazol-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-[(1-methylpyrazol-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 115949050 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 9-[(1-methylpyrazol-3-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cn1ccc(CN2C(=O)NC(=O)C3(CCCC3)C2=O)n1 |
| InChI | InChI=1S/C13H16N4O3/c1-16-7-4-9(15-16)8-17-11(19)13(5-2-3-6-13)10(18)14-12(17)20/h4,7H,2-3,5-6,8H2,1H3,(H,14,18,20) |
| InChIKey | BOYSHDXSOJQEOT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|