About (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole
(4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole (PubChem CID 11594924) has the molecular formula C21H27N3
and a molecular weight of 321.47 g/mol. Its IUPAC name is (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole.
Molecular Properties
| Compound Name | (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole |
| PubChem CID | 11594924 |
| Molecular Formula | C21H27N3 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole |
| SMILES | CC1CCN(C/C=C2\CCCc3c2cnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C21H27N3/c1-17-10-13-23(14-11-17)15-12-18-6-5-9-21-20(18)16-22-24(21)19-7-3-2-4-8-19/h2-4,7-8,12,16-17H,5-6,9-11,13-15H2,1H3/b18-12+ |
| InChIKey | GEBIURUDWDHDQM-LDADJPATSA-N |
| XLogP | 4.32 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole?
The IUPAC name of (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole (CID 11594924) is (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole.
What is the SMILES notation for (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole?
The canonical SMILES for (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole is CC1CCN(C/C=C2\CCCc3c2cnn3-c2ccccc2)CC1.
What is the InChIKey of (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole?
The InChIKey is GEBIURUDWDHDQM-LDADJPATSA-N. The full InChI is InChI=1S/C21H27N3/c1-17-10-13-23(14-11-17)15-12-18-6-5-9-21-20(18)16-22-24(21)19-7-3-2-4-8-19/h2-4,7-8,12,16-17H,5-6,9-11,13-15H2,1H3/b18-12+.
What are the key properties of (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole?
(4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole has a molecular weight of 321.47 g/mol, XLogP of 4.32, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-[2-(4-methylpiperidin-1-yl)ethylidene]-1-phenyl-6,7-dihydro-5H-indazole is sourced from PubChem (CID 11594924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).