C17H18FNO — CID 115951009
2-fluoro-6-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]phenol (PubChem CID 115951009) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-fluoro-6-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]phenol.
| Compound Name | 2-fluoro-6-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]phenol |
|---|---|
| PubChem CID | 115951009 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-fluoro-6-[(1,2,3,4-tetrahydronaphthalen-1-ylamino)methyl]phenol |
| SMILES | Oc1c(F)cccc1CNC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18FNO/c18-15-9-3-7-13(17(15)20)11-19-16-10-4-6-12-5-1-2-8-14(12)16/h1-3,5,7-9,16,19-20H,4,6,10-11H2 |
| InChIKey | QNXAFHHQDDWNOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|