About 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile
2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile (PubChem CID 11595174) has the molecular formula C15H16BrN3O
and a molecular weight of 334.22 g/mol. Its IUPAC name is 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile |
| PubChem CID | 11595174 |
| Molecular Formula | C15H16BrN3O |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile |
| SMILES | N#CC[C@@H]1COC[C@H](CC#N)N1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H16BrN3O/c16-13-3-1-12(2-4-13)9-19-14(5-7-17)10-20-11-15(19)6-8-18/h1-4,14-15H,5-6,9-11H2/t14-,15+ |
| InChIKey | USMRGHDIUXRBAJ-GASCZTMLSA-N |
| XLogP | 2.85 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile?
The IUPAC name of 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile (CID 11595174) is 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile.
What is the SMILES notation for 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile?
The canonical SMILES for 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile is N#CC[C@@H]1COC[C@H](CC#N)N1Cc1ccc(Br)cc1.
What is the InChIKey of 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile?
The InChIKey is USMRGHDIUXRBAJ-GASCZTMLSA-N. The full InChI is InChI=1S/C15H16BrN3O/c16-13-3-1-12(2-4-13)9-19-14(5-7-17)10-20-11-15(19)6-8-18/h1-4,14-15H,5-6,9-11H2/t14-,15+.
What are the key properties of 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile?
2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile has a molecular weight of 334.22 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R,5S)-4-[(4-bromophenyl)methyl]-5-(cyanomethyl)morpholin-3-yl]acetonitrile is sourced from PubChem (CID 11595174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).