C16H23ClN2O2 — CID 115952913
2-[2-chloro-6-(ethylaminomethyl)phenoxy]-N-cyclopentylacetamide (PubChem CID 115952913) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.82 g/mol. Its IUPAC name is 2-[2-chloro-6-(ethylaminomethyl)phenoxy]-N-cyclopentylacetamide.
| Compound Name | 2-[2-chloro-6-(ethylaminomethyl)phenoxy]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 115952913 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.82 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-[2-chloro-6-(ethylaminomethyl)phenoxy]-N-cyclopentylacetamide |
| SMILES | CCNCc1cccc(Cl)c1OCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-2-18-10-12-6-5-9-14(17)16(12)21-11-15(20)19-13-7-3-4-8-13/h5-6,9,13,18H,2-4,7-8,10-11H2,1H3,(H,19,20) |
| InChIKey | MTNBMVICDQEISP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |