C21H26O4 — CID 11595333
methyl (4R,4aR,11bS)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,8-hexahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate (PubChem CID 11595333) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is methyl (4R,4aR,11bS)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,8-hexahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate.
| Compound Name | methyl (4R,4aR,11bS)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,8-hexahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 11595333 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | methyl (4R,4aR,11bS)-4,7,11b-trimethyl-9-oxo-2,3,4a,5,6,8-hexahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@]2(C)c3cc4c(c(C)c3CC[C@@H]12)CC(=O)O4 |
| InChI | InChI=1S/C21H26O4/c1-12-13-6-7-17-20(2,8-5-9-21(17,3)19(23)24-4)15(13)11-16-14(12)10-18(22)25-16/h11,17H,5-10H2,1-4H3/t17-,20-,21-/m1/s1 |
| InChIKey | JEQZYODIZNIDJE-DUXKGJEZSA-N |
| XLogP | 3.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|