About N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide
N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide (PubChem CID 11595341) has the molecular formula C16H26N2O2S2
and a molecular weight of 342.53 g/mol. Its IUPAC name is N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide.
Molecular Properties
| Compound Name | N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide |
| PubChem CID | 11595341 |
| Molecular Formula | C16H26N2O2S2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide |
| SMILES | CC(C)(C)c1csc(CC(=O)CCCCCNC(=O)CS)n1 |
| InChI | InChI=1S/C16H26N2O2S2/c1-16(2,3)13-11-22-15(18-13)9-12(19)7-5-4-6-8-17-14(20)10-21/h11,21H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | FLQDDJVZMSWCKR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide?
The IUPAC name of N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide (CID 11595341) is N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide.
What is the SMILES notation for N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide?
The canonical SMILES for N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide is CC(C)(C)c1csc(CC(=O)CCCCCNC(=O)CS)n1.
What is the InChIKey of N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide?
The InChIKey is FLQDDJVZMSWCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O2S2/c1-16(2,3)13-11-22-15(18-13)9-12(19)7-5-4-6-8-17-14(20)10-21/h11,21H,4-10H2,1-3H3,(H,17,20).
What are the key properties of N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide?
N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide has a molecular weight of 342.53 g/mol, XLogP of 3.16, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-(4-tert-butyl-1,3-thiazol-2-yl)-6-oxoheptyl]-2-sulfanylacetamide is sourced from PubChem (CID 11595341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).