About didecyl(dimethyl)azanium hydroxide
didecyl(dimethyl)azanium hydroxide (PubChem CID 11595363) has the molecular formula C22H49NO
and a molecular weight of 343.64 g/mol. Its IUPAC name is didecyl(dimethyl)azanium hydroxide.
Molecular Properties
| Compound Name | didecyl(dimethyl)azanium hydroxide |
| PubChem CID | 11595363 |
| Molecular Formula | C22H49NO |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 343.38 |
| IUPAC Name | didecyl(dimethyl)azanium hydroxide |
| SMILES | CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[OH-] |
| InChI | InChI=1S/C22H48N.H2O/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H2/q+1;/p-1 |
| InChIKey | FAEUZVNNXJDELC-UHFFFAOYSA-M |
| XLogP | 7.17 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze didecyl(dimethyl)azanium hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl(dimethyl)azanium hydroxide?
The IUPAC name of didecyl(dimethyl)azanium hydroxide (CID 11595363) is didecyl(dimethyl)azanium hydroxide.
What is the SMILES notation for didecyl(dimethyl)azanium hydroxide?
The canonical SMILES for didecyl(dimethyl)azanium hydroxide is CCCCCCCCCC[N+](C)(C)CCCCCCCCCC.[OH-].
What is the InChIKey of didecyl(dimethyl)azanium hydroxide?
The InChIKey is FAEUZVNNXJDELC-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H48N.H2O/c1-5-7-9-11-13-15-17-19-21-23(3,4)22-20-18-16-14-12-10-8-6-2;/h5-22H2,1-4H3;1H2/q+1;/p-1.
What are the key properties of didecyl(dimethyl)azanium hydroxide?
didecyl(dimethyl)azanium hydroxide has a molecular weight of 343.64 g/mol, XLogP of 7.17, 18 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl(dimethyl)azanium hydroxide is sourced from PubChem (CID 11595363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).