C16H22ClNO2 — CID 115953760
N-[[3-chloro-2-[2-(oxolan-2-yl)ethoxy]phenyl]methyl]cyclopropanamine (PubChem CID 115953760) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is N-[[3-chloro-2-[2-(oxolan-2-yl)ethoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-chloro-2-[2-(oxolan-2-yl)ethoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 115953760 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[[3-chloro-2-[2-(oxolan-2-yl)ethoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Clc1cccc(CNC2CC2)c1OCCC1CCCO1 |
| InChI | InChI=1S/C16H22ClNO2/c17-15-5-1-3-12(11-18-13-6-7-13)16(15)20-10-8-14-4-2-9-19-14/h1,3,5,13-14,18H,2,4,6-11H2 |
| InChIKey | JLLSZAAIJDGIBI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |