C15H19ClN2O2 — CID 115954513
2-[2-chloro-6-[(propan-2-ylamino)methyl]phenoxy]-N-prop-2-ynylacetamide (PubChem CID 115954513) has the molecular formula C15H19ClN2O2 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-[2-chloro-6-[(propan-2-ylamino)methyl]phenoxy]-N-prop-2-ynylacetamide.
| Compound Name | 2-[2-chloro-6-[(propan-2-ylamino)methyl]phenoxy]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 115954513 |
| Molecular Formula | C15H19ClN2O2 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2-[2-chloro-6-[(propan-2-ylamino)methyl]phenoxy]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COc1c(Cl)cccc1CNC(C)C |
| InChI | InChI=1S/C15H19ClN2O2/c1-4-8-17-14(19)10-20-15-12(9-18-11(2)3)6-5-7-13(15)16/h1,5-7,11,18H,8-10H2,2-3H3,(H,17,19) |
| InChIKey | JOOTYWQOJGVTSV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|