C14H18FNO5 — CID 115956076
3-fluoro-2-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]oxybenzoic acid (PubChem CID 115956076) has the molecular formula C14H18FNO5 and a molecular weight of 299.30 g/mol. Its IUPAC name is 3-fluoro-2-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]oxybenzoic acid.
| Compound Name | 3-fluoro-2-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]oxybenzoic acid |
|---|---|
| PubChem CID | 115956076 |
| Molecular Formula | C14H18FNO5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-fluoro-2-[1-(3-methoxypropylamino)-1-oxopropan-2-yl]oxybenzoic acid |
| SMILES | COCCCNC(=O)C(C)Oc1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C14H18FNO5/c1-9(13(17)16-7-4-8-20-2)21-12-10(14(18)19)5-3-6-11(12)15/h3,5-6,9H,4,7-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | KIOVBMURFIMFPK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|