C17H19ClO2 — CID 115956314
[3-chloro-2-[(2,4,6-trimethylphenyl)methoxy]phenyl]methanol (PubChem CID 115956314) has the molecular formula C17H19ClO2 and a molecular weight of 290.79 g/mol. Its IUPAC name is [3-chloro-2-[(2,4,6-trimethylphenyl)methoxy]phenyl]methanol.
| Compound Name | [3-chloro-2-[(2,4,6-trimethylphenyl)methoxy]phenyl]methanol |
|---|---|
| PubChem CID | 115956314 |
| Molecular Formula | C17H19ClO2 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | [3-chloro-2-[(2,4,6-trimethylphenyl)methoxy]phenyl]methanol |
| SMILES | Cc1cc(C)c(COc2c(Cl)cccc2CO)c(C)c1 |
| InChI | InChI=1S/C17H19ClO2/c1-11-7-12(2)15(13(3)8-11)10-20-17-14(9-19)5-4-6-16(17)18/h4-8,19H,9-10H2,1-3H3 |
| InChIKey | YCAKKEDTRKNSSR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |