C16H19ClO4 — CID 115957079
(E)-3-[3-chloro-2-(3-methoxycyclohexyl)oxyphenyl]prop-2-enoic acid (PubChem CID 115957079) has the molecular formula C16H19ClO4 and a molecular weight of 310.78 g/mol. Its IUPAC name is (E)-3-[3-chloro-2-(3-methoxycyclohexyl)oxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-2-(3-methoxycyclohexyl)oxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115957079 |
| Molecular Formula | C16H19ClO4 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (E)-3-[3-chloro-2-(3-methoxycyclohexyl)oxyphenyl]prop-2-enoic acid |
| SMILES | COC1CCCC(Oc2c(Cl)cccc2/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C16H19ClO4/c1-20-12-5-3-6-13(10-12)21-16-11(8-9-15(18)19)4-2-7-14(16)17/h2,4,7-9,12-13H,3,5-6,10H2,1H3,(H,18,19)/b9-8+ |
| InChIKey | QFVLURYEBCGIAV-CMDGGOBGSA-N |
| XLogP | 3.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|