C16H17NO4 — CID 115957207
(E)-3-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methylphenyl]prop-2-enoic acid (PubChem CID 115957207) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is (E)-3-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115957207 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (E)-3-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]-3-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cccc(/C=C/C(=O)O)c1OCc1c(C)noc1C |
| InChI | InChI=1S/C16H17NO4/c1-10-5-4-6-13(7-8-15(18)19)16(10)20-9-14-11(2)17-21-12(14)3/h4-8H,9H2,1-3H3,(H,18,19)/b8-7+ |
| InChIKey | IJPNXTPFMCTURU-BQYQJAHWSA-N |
| XLogP | 3.28 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|