About 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one
6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one (PubChem CID 11595790) has the molecular formula C21H25FN4O
and a molecular weight of 368.46 g/mol. Its IUPAC name is 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one |
| PubChem CID | 11595790 |
| Molecular Formula | C21H25FN4O |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2cc(F)ccc2C1CCCCN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C21H25FN4O/c22-16-7-8-17-18(21(27)24-19(17)15-16)5-2-4-10-25-11-13-26(14-12-25)20-6-1-3-9-23-20/h1,3,6-9,15,18H,2,4-5,10-14H2,(H,24,27) |
| InChIKey | NDEQQLAZHRZSEI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one?
The IUPAC name of 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one (CID 11595790) is 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one.
What is the SMILES notation for 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one?
The canonical SMILES for 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one is O=C1Nc2cc(F)ccc2C1CCCCN1CCN(c2ccccn2)CC1.
What is the InChIKey of 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one?
The InChIKey is NDEQQLAZHRZSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN4O/c22-16-7-8-17-18(21(27)24-19(17)15-16)5-2-4-10-25-11-13-26(14-12-25)20-6-1-3-9-23-20/h1,3,6-9,15,18H,2,4-5,10-14H2,(H,24,27).
What are the key properties of 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one?
6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one has a molecular weight of 368.46 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-dihydroindol-2-one is sourced from PubChem (CID 11595790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).