About [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 11595794) has the molecular formula C23H32N2O2
and a molecular weight of 368.52 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| PubChem CID | 11595794 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)N1CCc2ccccc2C1C1CCCCC1 |
| InChI | InChI=1S/C23H32N2O2/c26-23(27-21-16-24-13-10-18(21)11-14-24)25-15-12-17-6-4-5-9-20(17)22(25)19-7-2-1-3-8-19/h4-6,9,18-19,21-22H,1-3,7-8,10-16H2/t21-,22?/m0/s1 |
| InChIKey | FCXWHPXCAHMELT-HMTLIYDFSA-N |
| XLogP | 4.40 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 11595794) is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is O=C(O[C@H]1CN2CCC1CC2)N1CCc2ccccc2C1C1CCCCC1.
What is the InChIKey of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is FCXWHPXCAHMELT-HMTLIYDFSA-N. The full InChI is InChI=1S/C23H32N2O2/c26-23(27-21-16-24-13-10-18(21)11-14-24)25-15-12-17-6-4-5-9-20(17)22(25)19-7-2-1-3-8-19/h4-6,9,18-19,21-22H,1-3,7-8,10-16H2/t21-,22?/m0/s1.
What are the key properties of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 368.52 g/mol, XLogP of 4.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-cyclohexyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 11595794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).