About 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol
2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol (PubChem CID 115958889) has the molecular formula C16H17ClN2O
and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol.
Molecular Properties
| Compound Name | 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol |
| PubChem CID | 115958889 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol |
| SMILES | CN1CCN(Cc2cccc(Cl)c2O)c2ccccc21 |
| InChI | InChI=1S/C16H17ClN2O/c1-18-9-10-19(15-8-3-2-7-14(15)18)11-12-5-4-6-13(17)16(12)20/h2-8,20H,9-11H2,1H3 |
| InChIKey | UJVSFLQJCRQBHS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol?
The IUPAC name of 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol (CID 115958889) is 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol.
What is the SMILES notation for 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol?
The canonical SMILES for 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol is CN1CCN(Cc2cccc(Cl)c2O)c2ccccc21.
What is the InChIKey of 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol?
The InChIKey is UJVSFLQJCRQBHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O/c1-18-9-10-19(15-8-3-2-7-14(15)18)11-12-5-4-6-13(17)16(12)20/h2-8,20H,9-11H2,1H3.
What are the key properties of 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol?
2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol has a molecular weight of 288.78 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-[(4-methyl-2,3-dihydroquinoxalin-1-yl)methyl]phenol is sourced from PubChem (CID 115958889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).