C25H27NO2 — CID 11595898
(3R,8aR)-3,8a-diphenyl-6,6-bis(prop-2-enyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one (PubChem CID 11595898) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (3R,8aR)-3,8a-diphenyl-6,6-bis(prop-2-enyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one.
| Compound Name | (3R,8aR)-3,8a-diphenyl-6,6-bis(prop-2-enyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11595898 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (3R,8aR)-3,8a-diphenyl-6,6-bis(prop-2-enyl)-2,3,7,8-tetrahydro-[1,3]oxazolo[3,2-a]pyridin-5-one |
| SMILES | C=CCC1(CC=C)CC[C@]2(c3ccccc3)OC[C@@H](c3ccccc3)N2C1=O |
| InChI | InChI=1S/C25H27NO2/c1-3-15-24(16-4-2)17-18-25(21-13-9-6-10-14-21)26(23(24)27)22(19-28-25)20-11-7-5-8-12-20/h3-14,22H,1-2,15-19H2/t22-,25+/m0/s1 |
| InChIKey | CJXYMJDAPOOGCG-WIOPSUGQSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|