C16H10BrF2NO — CID 115959949
(5-bromoquinolin-8-yl)-(3,4-difluorophenyl)methanol (PubChem CID 115959949) has the molecular formula C16H10BrF2NO and a molecular weight of 350.16 g/mol. Its IUPAC name is (5-bromoquinolin-8-yl)-(3,4-difluorophenyl)methanol.
| Compound Name | (5-bromoquinolin-8-yl)-(3,4-difluorophenyl)methanol |
|---|---|
| PubChem CID | 115959949 |
| Molecular Formula | C16H10BrF2NO |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (5-bromoquinolin-8-yl)-(3,4-difluorophenyl)methanol |
| SMILES | OC(c1ccc(F)c(F)c1)c1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C16H10BrF2NO/c17-12-5-4-11(15-10(12)2-1-7-20-15)16(21)9-3-6-13(18)14(19)8-9/h1-8,16,21H |
| InChIKey | LRDUNJSJOVYNEY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |