C16H19BrN2O2 — CID 115960512
2-[(5-bromoquinolin-8-yl)methyl-butan-2-ylamino]acetic acid (PubChem CID 115960512) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-[(5-bromoquinolin-8-yl)methyl-butan-2-ylamino]acetic acid.
| Compound Name | 2-[(5-bromoquinolin-8-yl)methyl-butan-2-ylamino]acetic acid |
|---|---|
| PubChem CID | 115960512 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-[(5-bromoquinolin-8-yl)methyl-butan-2-ylamino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)Cc1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C16H19BrN2O2/c1-3-11(2)19(10-15(20)21)9-12-6-7-14(17)13-5-4-8-18-16(12)13/h4-8,11H,3,9-10H2,1-2H3,(H,20,21) |
| InChIKey | ZACUFCWSKWVXTM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |