C23H30O5 — CID 11596174
(1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11596174) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11596174 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2-methoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | CCc1ccc(Cc2ccc(OC)c([C@@H]3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C23H30O5/c1-3-14-4-6-15(7-5-14)10-16-8-9-20(28-2)18(11-16)19-12-17(13-24)21(25)23(27)22(19)26/h4-9,11,17,19,21-27H,3,10,12-13H2,1-2H3/t17-,19+,21-,22+,23+/m1/s1 |
| InChIKey | RAYPQIFWKYQIKX-HTKBXHQZSA-N |
| XLogP | 2.03 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |