C16H24BrNO3 — CID 115962241
2-[4-bromo-2-(hydroxymethyl)-6-methylphenoxy]-N-(2-methylbutan-2-yl)propanamide (PubChem CID 115962241) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 2-[4-bromo-2-(hydroxymethyl)-6-methylphenoxy]-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-[4-bromo-2-(hydroxymethyl)-6-methylphenoxy]-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 115962241 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[4-bromo-2-(hydroxymethyl)-6-methylphenoxy]-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(C)(C)NC(=O)C(C)Oc1c(C)cc(Br)cc1CO |
| InChI | InChI=1S/C16H24BrNO3/c1-6-16(4,5)18-15(20)11(3)21-14-10(2)7-13(17)8-12(14)9-19/h7-8,11,19H,6,9H2,1-5H3,(H,18,20) |
| InChIKey | JZQLLBLEAOQKQY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |